C27H33N3O3S — CID 92697020
(2E)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 92697020) has the molecular formula C27H33N3O3S and a molecular weight of 479.65 g/mol. Its IUPAC name is (2E)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2E)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 92697020 |
| Molecular Formula | C27H33N3O3S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (2E)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-2-[(4-methoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(/C=C2/Sc3ccc(C(=O)NCCCN4C[C@H](C)C[C@@H](C)C4)cc3NC2=O)cc1 |
| InChI | InChI=1S/C27H33N3O3S/c1-18-13-19(2)17-30(16-18)12-4-11-28-26(31)21-7-10-24-23(15-21)29-27(32)25(34-24)14-20-5-8-22(33-3)9-6-20/h5-10,14-15,18-19H,4,11-13,16-17H2,1-3H3,(H,28,31)(H,29,32)/b25-14+/t18-,19-/m1/s1 |
| InChIKey | KQEHRABQPQLMIM-QIHAAUELSA-N |
| XLogP | 4.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|