C17H12N2O2S — CID 126115119
2-[4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]acetonitrile (PubChem CID 126115119) has the molecular formula C17H12N2O2S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 126115119 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(/C=C2\Sc3ccccc3NC2=O)cc1 |
| InChI | InChI=1S/C17H12N2O2S/c18-9-10-21-13-7-5-12(6-8-13)11-16-17(20)19-14-3-1-2-4-15(14)22-16/h1-8,11H,10H2,(H,19,20)/b16-11- |
| InChIKey | VYYJROCKFLHFKV-WJDWOHSUSA-N |
| XLogP | 3.67 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|