C18H13I2NO2S — CID 126104296
(2Z)-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126104296) has the molecular formula C18H13I2NO2S and a molecular weight of 561.18 g/mol. Its IUPAC name is (2Z)-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126104296 |
| Molecular Formula | C18H13I2NO2S |
| Molecular Weight | 561.18 g/mol |
| Exact Mass | 560.88 |
| IUPAC Name | (2Z)-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | C=CCOc1c(I)cc(/C=C2\Sc3ccccc3NC2=O)cc1I |
| InChI | InChI=1S/C18H13I2NO2S/c1-2-7-23-17-12(19)8-11(9-13(17)20)10-16-18(22)21-14-5-3-4-6-15(14)24-16/h2-6,8-10H,1,7H2,(H,21,22)/b16-10- |
| InChIKey | MXHUSHMGOILXCS-YBEGLDIGSA-N |
| XLogP | 5.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.18 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|