C20H16I2N2O3S — CID 137081010
(5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137081010) has the molecular formula C20H16I2N2O3S and a molecular weight of 618.23 g/mol. Its IUPAC name is (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137081010 |
| Molecular Formula | C20H16I2N2O3S |
| Molecular Weight | 618.23 g/mol |
| Exact Mass | 617.90 |
| IUPAC Name | (5E)-5-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylidene]-2-(4-methoxyphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1c(I)cc(/C=C2/S/C(=N\c3ccc(OC)cc3)NC2=O)cc1I |
| InChI | InChI=1S/C20H16I2N2O3S/c1-3-8-27-18-15(21)9-12(10-16(18)22)11-17-19(25)24-20(28-17)23-13-4-6-14(26-2)7-5-13/h3-7,9-11H,1,8H2,2H3,(H,23,24,25)/b17-11+ |
| InChIKey | CWLXWUVAODZCTL-GZTJUZNOSA-N |
| XLogP | 5.36 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.23 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|