C22H14ClI2NO2S — CID 126112247
(2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126112247) has the molecular formula C22H14ClI2NO2S and a molecular weight of 645.69 g/mol. Its IUPAC name is (2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126112247 |
| Molecular Formula | C22H14ClI2NO2S |
| Molecular Weight | 645.69 g/mol |
| Exact Mass | 644.85 |
| IUPAC Name | (2Z)-2-[[4-[(2-chlorophenyl)methoxy]-3,5-diiodophenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1Nc2ccccc2S/C1=C\c1cc(I)c(OCc2ccccc2Cl)c(I)c1 |
| InChI | InChI=1S/C22H14ClI2NO2S/c23-15-6-2-1-5-14(15)12-28-21-16(24)9-13(10-17(21)25)11-20-22(27)26-18-7-3-4-8-19(18)29-20/h1-11H,12H2,(H,26,27)/b20-11- |
| InChIKey | JYMHSWVUKRRLBF-JAIQZWGSSA-N |
| XLogP | 7.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|