C36H38N3O2S+ — CID 3467039
benzyl-[3-[[2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carbonyl]amino]propyl]-ethylazanium (PubChem CID 3467039) has the molecular formula C36H38N3O2S+ and a molecular weight of 576.79 g/mol. Its IUPAC name is benzyl-[3-[[2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carbonyl]amino]propyl]-ethylazanium.
| Compound Name | benzyl-[3-[[2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carbonyl]amino]propyl]-ethylazanium |
|---|---|
| PubChem CID | 3467039 |
| Molecular Formula | C36H38N3O2S+ |
| Molecular Weight | 576.79 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | benzyl-[3-[[2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carbonyl]amino]propyl]-ethylazanium |
| SMILES | CC[NH+](CCCNC(=O)c1ccc2c(c1)N(Cc1cccc(C)c1)C(=O)C(=Cc1ccccc1)S2)Cc1ccccc1 |
| InChI | InChI=1S/C36H37N3O2S/c1-3-38(25-29-15-8-5-9-16-29)21-11-20-37-35(40)31-18-19-33-32(24-31)39(26-30-17-10-12-27(2)22-30)36(41)34(42-33)23-28-13-6-4-7-14-28/h4-10,12-19,22-24H,3,11,20-21,25-26H2,1-2H3,(H,37,40)/p+1 |
| InChIKey | MDBVYNFVMZBDPU-UHFFFAOYSA-O |
| XLogP | 5.90 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.79 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|