C34H32N2O4S — CID 6034350
(2Z)-2-benzylidene-N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 6034350) has the molecular formula C34H32N2O4S and a molecular weight of 564.71 g/mol. Its IUPAC name is (2Z)-2-benzylidene-N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6034350 |
| Molecular Formula | C34H32N2O4S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | (2Z)-2-benzylidene-N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(OC)c(CCNC(=O)c2ccc3c(c2)N(Cc2cccc(C)c2)C(=O)/C(=C/c2ccccc2)S3)c1 |
| InChI | InChI=1S/C34H32N2O4S/c1-23-8-7-11-25(18-23)22-36-29-21-27(33(37)35-17-16-26-20-28(39-2)13-14-30(26)40-3)12-15-31(29)41-32(34(36)38)19-24-9-5-4-6-10-24/h4-15,18-21H,16-17,22H2,1-3H3,(H,35,37)/b32-19- |
| InChIKey | QBZZJDXCXSTKGP-MZFJOGFUSA-N |
| XLogP | 6.66 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|