C27H30ClN3O2S — CID 3456694
2-[(3-chlorophenyl)methylidene]-6-(4-cyclohexylpiperazine-1-carbonyl)-4-methyl-1,4-benzothiazin-3-one (PubChem CID 3456694) has the molecular formula C27H30ClN3O2S and a molecular weight of 496.08 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylidene]-6-(4-cyclohexylpiperazine-1-carbonyl)-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3-chlorophenyl)methylidene]-6-(4-cyclohexylpiperazine-1-carbonyl)-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 3456694 |
| Molecular Formula | C27H30ClN3O2S |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 2-[(3-chlorophenyl)methylidene]-6-(4-cyclohexylpiperazine-1-carbonyl)-4-methyl-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)C(=Cc2cccc(Cl)c2)Sc2ccc(C(=O)N3CCN(C4CCCCC4)CC3)cc21 |
| InChI | InChI=1S/C27H30ClN3O2S/c1-29-23-18-20(26(32)31-14-12-30(13-15-31)22-8-3-2-4-9-22)10-11-24(23)34-25(27(29)33)17-19-6-5-7-21(28)16-19/h5-7,10-11,16-18,22H,2-4,8-9,12-15H2,1H3 |
| InChIKey | SFVDGIQMRMBWDR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|