C28H26N4O4S — CID 46250278
(2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-6-[4-(4-nitrophenyl)piperazine-1-carbonyl]-1,4-benzothiazin-3-one (PubChem CID 46250278) has the molecular formula C28H26N4O4S and a molecular weight of 514.61 g/mol. Its IUPAC name is (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-6-[4-(4-nitrophenyl)piperazine-1-carbonyl]-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-6-[4-(4-nitrophenyl)piperazine-1-carbonyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250278 |
| Molecular Formula | C28H26N4O4S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (2Z)-4-methyl-2-[(3-methylphenyl)methylidene]-6-[4-(4-nitrophenyl)piperazine-1-carbonyl]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(/C=C2\Sc3ccc(C(=O)N4CCN(c5ccc([N+](=O)[O-])cc5)CC4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C28H26N4O4S/c1-19-4-3-5-20(16-19)17-26-28(34)29(2)24-18-21(6-11-25(24)37-26)27(33)31-14-12-30(13-15-31)22-7-9-23(10-8-22)32(35)36/h3-11,16-18H,12-15H2,1-2H3/b26-17- |
| InChIKey | WUKOJNBMOBXWBZ-ONUIUJJFSA-N |
| XLogP | 4.98 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|