C32H34FN3O2S — CID 58538887
(2Z)-6-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentanoyl]-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one (PubChem CID 58538887) has the molecular formula C32H34FN3O2S and a molecular weight of 543.71 g/mol. Its IUPAC name is (2Z)-6-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentanoyl]-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-6-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentanoyl]-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 58538887 |
| Molecular Formula | C32H34FN3O2S |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | (2Z)-6-[5-[4-(2-fluorophenyl)piperazin-1-yl]pentanoyl]-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(/C=C2\Sc3ccc(C(=O)CCCCN4CCN(c5ccccc5F)CC4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C32H34FN3O2S/c1-23-8-7-9-24(20-23)21-31-32(38)34(2)28-22-25(13-14-30(28)39-31)29(37)12-5-6-15-35-16-18-36(19-17-35)27-11-4-3-10-26(27)33/h3-4,7-11,13-14,20-22H,5-6,12,15-19H2,1-2H3/b31-21- |
| InChIKey | RQIIFUVXGXSOKU-YQYKVWLJSA-N |
| XLogP | 6.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|