C26H22ClN3O3 — CID 46296691
(2Z)-2-[(2-chlorophenyl)methylidene]-6-(4-phenylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 46296691) has the molecular formula C26H22ClN3O3 and a molecular weight of 459.93 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-6-(4-phenylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(4-phenylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46296691 |
| Molecular Formula | C26H22ClN3O3 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(4-phenylpiperazine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc(C(=O)N3CCN(c4ccccc4)CC3)ccc2O/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C26H22ClN3O3/c27-21-9-5-4-6-18(21)17-24-25(31)28-22-16-19(10-11-23(22)33-24)26(32)30-14-12-29(13-15-30)20-7-2-1-3-8-20/h1-11,16-17H,12-15H2,(H,28,31)/b24-17- |
| InChIKey | SYIKOOLFRDXOKM-ULJHMMPZSA-N |
| XLogP | 4.67 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|