C24H19ClN2O3 — CID 92867443
(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(1R)-1-phenylethyl]-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 92867443) has the molecular formula C24H19ClN2O3 and a molecular weight of 418.88 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(1R)-1-phenylethyl]-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(1R)-1-phenylethyl]-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 92867443 |
| Molecular Formula | C24H19ClN2O3 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(1R)-1-phenylethyl]-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccccc1Cl)O2)c1ccccc1 |
| InChI | InChI=1S/C24H19ClN2O3/c1-15(16-7-3-2-4-8-16)26-23(28)18-11-12-21-20(13-18)27-24(29)22(30-21)14-17-9-5-6-10-19(17)25/h2-15H,1H3,(H,26,28)(H,27,29)/b22-14-/t15-/m1/s1 |
| InChIKey | DWTYIWSRJPSTDY-YZLQOSHFSA-N |
| XLogP | 5.20 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|