C25H21ClN2O3 — CID 92867447
(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(2R)-2-phenylpropyl]-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 92867447) has the molecular formula C25H21ClN2O3 and a molecular weight of 432.91 g/mol. Its IUPAC name is (2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(2R)-2-phenylpropyl]-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(2R)-2-phenylpropyl]-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 92867447 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-[(2R)-2-phenylpropyl]-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | C[C@@H](CNC(=O)c1ccc2c(c1)NC(=O)/C(=C\c1ccccc1Cl)O2)c1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O3/c1-16(17-7-3-2-4-8-17)15-27-24(29)19-11-12-22-21(13-19)28-25(30)23(31-22)14-18-9-5-6-10-20(18)26/h2-14,16H,15H2,1H3,(H,27,29)(H,28,30)/b23-14+/t16-/m0/s1 |
| InChIKey | HPHSURMAJCVIJG-YQCVNYCESA-N |
| XLogP | 5.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|