C20H17ClN2O3 — CID 46296693
(2Z)-2-[(2-chlorophenyl)methylidene]-6-(pyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 46296693) has the molecular formula C20H17ClN2O3 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-6-(pyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(pyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46296693 |
| Molecular Formula | C20H17ClN2O3 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(pyrrolidine-1-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc(C(=O)N3CCCC3)ccc2O/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O3/c21-15-6-2-1-5-13(15)12-18-19(24)22-16-11-14(7-8-17(16)26-18)20(25)23-9-3-4-10-23/h1-2,5-8,11-12H,3-4,9-10H2,(H,22,24)/b18-12- |
| InChIKey | DLHVIYFGAWKNQE-PDGQHHTCSA-N |
| XLogP | 3.95 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|