C20H17ClN2O4 — CID 46296703
(2Z)-2-[(2-chlorophenyl)methylidene]-6-(morpholine-4-carbonyl)-4H-1,4-benzoxazin-3-one (PubChem CID 46296703) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-6-(morpholine-4-carbonyl)-4H-1,4-benzoxazin-3-one.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(morpholine-4-carbonyl)-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46296703 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-6-(morpholine-4-carbonyl)-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1Nc2cc(C(=O)N3CCOCC3)ccc2O/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C20H17ClN2O4/c21-15-4-2-1-3-13(15)12-18-19(24)22-16-11-14(5-6-17(16)27-18)20(25)23-7-9-26-10-8-23/h1-6,11-12H,7-10H2,(H,22,24)/b18-12- |
| InChIKey | DZQGASBJXRDTTG-PDGQHHTCSA-N |
| XLogP | 3.18 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|