C28H27N3O5 — CID 46296611
(2E)-2-[(2-methoxyphenyl)methylidene]-6-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 46296611) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is (2E)-2-[(2-methoxyphenyl)methylidene]-6-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | (2E)-2-[(2-methoxyphenyl)methylidene]-6-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 46296611 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (2E)-2-[(2-methoxyphenyl)methylidene]-6-[4-(3-methoxyphenyl)piperazine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cccc(N2CCN(C(=O)c3ccc4c(c3)NC(=O)/C(=C\c3ccccc3OC)O4)CC2)c1 |
| InChI | InChI=1S/C28H27N3O5/c1-34-22-8-5-7-21(18-22)30-12-14-31(15-13-30)28(33)20-10-11-25-23(16-20)29-27(32)26(36-25)17-19-6-3-4-9-24(19)35-2/h3-11,16-18H,12-15H2,1-2H3,(H,29,32)/b26-17+ |
| InChIKey | ODSKESHUEZOULO-YZSQISJMSA-N |
| XLogP | 4.04 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|