C24H26ClN3O3 — CID 46296761
(2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-(3-pyrrolidin-1-ylbutyl)-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 46296761) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-(3-pyrrolidin-1-ylbutyl)-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-(3-pyrrolidin-1-ylbutyl)-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 46296761 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-3-oxo-N-(3-pyrrolidin-1-ylbutyl)-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CC(CCNC(=O)c1ccc2c(c1)NC(=O)/C(=C/c1ccccc1Cl)O2)N1CCCC1 |
| InChI | InChI=1S/C24H26ClN3O3/c1-16(28-12-4-5-13-28)10-11-26-23(29)18-8-9-21-20(14-18)27-24(30)22(31-21)15-17-6-2-3-7-19(17)25/h2-3,6-9,14-16H,4-5,10-13H2,1H3,(H,26,29)(H,27,30)/b22-15- |
| InChIKey | CORMPRMNKLWBSE-JCMHNJIXSA-N |
| XLogP | 4.32 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|