C25H21ClN2O5 — CID 46296751
(2Z)-2-[(2-chlorophenyl)methylidene]-N-[(2,4-dimethoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 46296751) has the molecular formula C25H21ClN2O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is (2Z)-2-[(2-chlorophenyl)methylidene]-N-[(2,4-dimethoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2Z)-2-[(2-chlorophenyl)methylidene]-N-[(2,4-dimethoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 46296751 |
| Molecular Formula | C25H21ClN2O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | (2Z)-2-[(2-chlorophenyl)methylidene]-N-[(2,4-dimethoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)NC(=O)/C(=C/c2ccccc2Cl)O3)c(OC)c1 |
| InChI | InChI=1S/C25H21ClN2O5/c1-31-18-9-7-17(22(13-18)32-2)14-27-24(29)16-8-10-21-20(11-16)28-25(30)23(33-21)12-15-5-3-4-6-19(15)26/h3-13H,14H2,1-2H3,(H,27,29)(H,28,30)/b23-12- |
| InChIKey | OFSNSSIZHITXGD-FMCGGJTJSA-N |
| XLogP | 4.66 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|