C26H23ClN2O5 — CID 46296848
(2E)-2-[(3-chlorophenyl)methylidene]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 46296848) has the molecular formula C26H23ClN2O5 and a molecular weight of 478.93 g/mol. Its IUPAC name is (2E)-2-[(3-chlorophenyl)methylidene]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | (2E)-2-[(3-chlorophenyl)methylidene]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 46296848 |
| Molecular Formula | C26H23ClN2O5 |
| Molecular Weight | 478.93 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (2E)-2-[(3-chlorophenyl)methylidene]-N-[(4-ethoxy-3-methoxyphenyl)methyl]-3-oxo-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc3c(c2)NC(=O)/C(=C\c2cccc(Cl)c2)O3)cc1OC |
| InChI | InChI=1S/C26H23ClN2O5/c1-3-33-22-9-7-17(13-23(22)32-2)15-28-25(30)18-8-10-21-20(14-18)29-26(31)24(34-21)12-16-5-4-6-19(27)11-16/h4-14H,3,15H2,1-2H3,(H,28,30)(H,29,31)/b24-12+ |
| InChIKey | BZRVVNQUMUGPQW-WYMPLXKRSA-N |
| XLogP | 5.05 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.93 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|