C21H19FN2O3S — CID 46250921
(2Z)-2-[(2-fluorophenyl)methylidene]-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzothiazin-3-one (PubChem CID 46250921) has the molecular formula C21H19FN2O3S and a molecular weight of 398.46 g/mol. Its IUPAC name is (2Z)-2-[(2-fluorophenyl)methylidene]-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(2-fluorophenyl)methylidene]-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250921 |
| Molecular Formula | C21H19FN2O3S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | (2Z)-2-[(2-fluorophenyl)methylidene]-4-(2-morpholin-4-yl-2-oxoethyl)-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2F)Sc2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C21H19FN2O3S/c22-16-6-2-1-5-15(16)13-19-21(26)24(17-7-3-4-8-18(17)28-19)14-20(25)23-9-11-27-12-10-23/h1-8,13H,9-12,14H2/b19-13- |
| InChIKey | LVWCIVWVMZWDOW-UYRXBGFRSA-N |
| XLogP | 3.16 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|