C31H35N3O2S — CID 126634612
4-[(Z)-[3-oxo-4-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]-1,4-benzothiazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide (PubChem CID 126634612) has the molecular formula C31H35N3O2S and a molecular weight of 513.71 g/mol. Its IUPAC name is 4-[(Z)-[3-oxo-4-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]-1,4-benzothiazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide.
| Compound Name | 4-[(Z)-[3-oxo-4-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]-1,4-benzothiazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 126634612 |
| Molecular Formula | C31H35N3O2S |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4-[(Z)-[3-oxo-4-[(2E)-2-[(E)-prop-1-enyl]penta-2,4-dienyl]-1,4-benzothiazin-2-ylidene]methyl]-N-(3-pyrrolidin-1-ylpropyl)benzamide |
| SMILES | C=C/C=C(\C=C\C)CN1C(=O)/C(=C/c2ccc(C(=O)NCCCN3CCCC3)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C31H35N3O2S/c1-3-10-25(11-4-2)23-34-27-12-5-6-13-28(27)37-29(31(34)36)22-24-14-16-26(17-15-24)30(35)32-18-9-21-33-19-7-8-20-33/h3-6,10-17,22H,1,7-9,18-21,23H2,2H3,(H,32,35)/b11-4+,25-10+,29-22- |
| InChIKey | FXVHLLURPNEZKN-INMAYXRVSA-N |
| XLogP | 6.07 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|