C26H24N2O4S — CID 4155226
2-[(3,4-dimethoxyphenyl)methylidene]-N-[(4-methylphenyl)methyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 4155226) has the molecular formula C26H24N2O4S and a molecular weight of 460.56 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylidene]-N-[(4-methylphenyl)methyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylidene]-N-[(4-methylphenyl)methyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 4155226 |
| Molecular Formula | C26H24N2O4S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylidene]-N-[(4-methylphenyl)methyl]-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(C=C2Sc3ccc(C(=O)NCc4ccc(C)cc4)cc3NC2=O)cc1OC |
| InChI | InChI=1S/C26H24N2O4S/c1-16-4-6-17(7-5-16)15-27-25(29)19-9-11-23-20(14-19)28-26(30)24(33-23)13-18-8-10-21(31-2)22(12-18)32-3/h4-14H,15H2,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | MDAXYHABQAJFMM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|