C18H13Br2ClN2O2S — CID 137136702
(5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137136702) has the molecular formula C18H13Br2ClN2O2S and a molecular weight of 516.64 g/mol. Its IUPAC name is (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136702 |
| Molecular Formula | C18H13Br2ClN2O2S |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 513.88 |
| IUPAC Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1c(Br)cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)cc1Br |
| InChI | InChI=1S/C18H13Br2ClN2O2S/c1-9-13(21)4-3-5-14(9)22-18-23-17(24)15(26-18)8-10-6-11(19)16(25-2)12(20)7-10/h3-8H,1-2H3,(H,22,23,24)/b15-8+ |
| InChIKey | SAMGOIZLMDWXSW-OVCLIPMQSA-N |
| XLogP | 6.07 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|