C24H16BrCl3N2O2S — CID 137077359
(5E)-5-[[3-bromo-5-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137077359) has the molecular formula C24H16BrCl3N2O2S and a molecular weight of 582.73 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-5-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-bromo-5-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137077359 |
| Molecular Formula | C24H16BrCl3N2O2S |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 579.92 |
| IUPAC Name | (5E)-5-[[3-bromo-5-chloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | Cc1c(Cl)cccc1/N=C1/NC(=O)/C(=C\c2cc(Cl)c(OCc3ccccc3Cl)c(Br)c2)S1 |
| InChI | InChI=1S/C24H16BrCl3N2O2S/c1-13-17(26)7-4-8-20(13)29-24-30-23(31)21(33-24)11-14-9-16(25)22(19(28)10-14)32-12-15-5-2-3-6-18(15)27/h2-11H,12H2,1H3,(H,29,30,31)/b21-11+ |
| InChIKey | BRVSAFKGYIZFQT-SRZZPIQSSA-N |
| XLogP | 8.19 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|