C24H13Br2Cl2N3O2S — CID 135463942
2-[[2,6-dibromo-4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile (PubChem CID 135463942) has the molecular formula C24H13Br2Cl2N3O2S and a molecular weight of 638.17 g/mol. Its IUPAC name is 2-[[2,6-dibromo-4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2,6-dibromo-4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 135463942 |
| Molecular Formula | C24H13Br2Cl2N3O2S |
| Molecular Weight | 638.17 g/mol |
| Exact Mass | 634.85 |
| IUPAC Name | 2-[[2,6-dibromo-4-[[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1c(Br)cc(C=C2S/C(=N\c3cccc(Cl)c3Cl)NC2=O)cc1Br |
| InChI | InChI=1S/C24H13Br2Cl2N3O2S/c25-16-8-13(9-17(26)22(16)33-12-15-5-2-1-4-14(15)11-29)10-20-23(32)31-24(34-20)30-19-7-3-6-18(27)21(19)28/h1-10H,12H2,(H,30,31,32) |
| InChIKey | AEZIOMDXYQISLQ-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.17 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|