C18H9BrCl3N3O2S — CID 137107919
2-[2-bromo-6-chloro-4-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile (PubChem CID 137107919) has the molecular formula C18H9BrCl3N3O2S and a molecular weight of 517.62 g/mol. Its IUPAC name is 2-[2-bromo-6-chloro-4-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-bromo-6-chloro-4-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 137107919 |
| Molecular Formula | C18H9BrCl3N3O2S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 514.87 |
| IUPAC Name | 2-[2-bromo-6-chloro-4-[(Z)-[2-(2,3-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetonitrile |
| SMILES | N#CCOc1c(Cl)cc(/C=C2\S/C(=N/c3cccc(Cl)c3Cl)NC2=O)cc1Br |
| InChI | InChI=1S/C18H9BrCl3N3O2S/c19-10-6-9(7-12(21)16(10)27-5-4-23)8-14-17(26)25-18(28-14)24-13-3-1-2-11(20)15(13)22/h1-3,6-8H,5H2,(H,24,25,26)/b14-8- |
| InChIKey | DXNWZGAHKQXIAN-ZSOIEALJSA-N |
| XLogP | 6.20 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|