C26H21BrCl2N2O3S — CID 137136538
(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 137136538) has the molecular formula C26H21BrCl2N2O3S and a molecular weight of 592.34 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137136538 |
| Molecular Formula | C26H21BrCl2N2O3S |
| Molecular Weight | 592.34 g/mol |
| Exact Mass | 589.98 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2-(3-chloro-2-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H21BrCl2N2O3S/c1-3-33-22-12-16(11-18(27)24(22)34-14-17-7-4-5-8-20(17)29)13-23-25(32)31-26(35-23)30-21-10-6-9-19(28)15(21)2/h4-13H,3,14H2,1-2H3,(H,30,31,32)/b23-13+ |
| InChIKey | IAEYLZLCALZOMD-YDZHTSKRSA-N |
| XLogP | 7.93 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.34 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|