C20H13ClI2N2O2S — CID 137077171
(5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 137077171) has the molecular formula C20H13ClI2N2O2S and a molecular weight of 634.66 g/mol. Its IUPAC name is (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137077171 |
| Molecular Formula | C20H13ClI2N2O2S |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 633.85 |
| IUPAC Name | (5E)-2-(3-chloro-2-methylphenyl)imino-5-[(3,5-diiodo-4-prop-2-ynoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C#CCOc1c(I)cc(/C=C2/S/C(=N\c3cccc(Cl)c3C)NC2=O)cc1I |
| InChI | InChI=1S/C20H13ClI2N2O2S/c1-3-7-27-18-14(22)8-12(9-15(18)23)10-17-19(26)25-20(28-17)24-16-6-4-5-13(21)11(16)2/h1,4-6,8-10H,7H2,2H3,(H,24,25,26)/b17-10+ |
| InChIKey | QQIDPAFLWHVWOB-LICLKQGHSA-N |
| XLogP | 5.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|