C18H14BrN3O4S — CID 16634356
2-[2-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromophenoxy]-N-(4-hydroxyphenyl)acetamide (PubChem CID 16634356) has the molecular formula C18H14BrN3O4S and a molecular weight of 448.30 g/mol. Its IUPAC name is 2-[2-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromophenoxy]-N-(4-hydroxyphenyl)acetamide.
| Compound Name | 2-[2-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromophenoxy]-N-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 16634356 |
| Molecular Formula | C18H14BrN3O4S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | 2-[2-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-4-bromophenoxy]-N-(4-hydroxyphenyl)acetamide |
| SMILES | NC1=NC(=O)/C(=C/c2cc(Br)ccc2OCC(=O)Nc2ccc(O)cc2)S1 |
| InChI | InChI=1S/C18H14BrN3O4S/c19-11-1-6-14(10(7-11)8-15-17(25)22-18(20)27-15)26-9-16(24)21-12-2-4-13(23)5-3-12/h1-8,23H,9H2,(H,21,24)(H2,20,22,25)/b15-8- |
| InChIKey | DAFQTFWCNJIJOH-NVNXTCNLSA-N |
| XLogP | 3.10 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|