C20H20N4O6S2 — CID 16634302
2-[4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16634302) has the molecular formula C20H20N4O6S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-[4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16634302 |
| Molecular Formula | C20H20N4O6S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-[4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenoxy]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | CCOc1cc(/C=C2\SC(N)=NC2=O)ccc1OCC(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H20N4O6S2/c1-2-29-16-9-12(10-17-19(26)24-20(21)31-17)3-8-15(16)30-11-18(25)23-13-4-6-14(7-5-13)32(22,27)28/h3-10H,2,11H2,1H3,(H,23,25)(H2,21,24,26)(H2,22,27,28)/b17-10- |
| InChIKey | IWBUFYUZVYUAQJ-YVLHZVERSA-N |
| XLogP | 1.68 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|