C23H18BrClN2O7S2 — CID 16628929
2-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 16628929) has the molecular formula C23H18BrClN2O7S2 and a molecular weight of 613.90 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 16628929 |
| Molecular Formula | C23H18BrClN2O7S2 |
| Molecular Weight | 613.90 g/mol |
| Exact Mass | 611.94 |
| IUPAC Name | 2-[(5Z)-5-[[5-bromo-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)/C(=C/c2cc(Br)ccc2OCC(=O)Nc2ccc(Cl)cc2)SC1=S |
| InChI | InChI=1S/C23H18BrClN2O7S2/c24-13-1-7-17(34-11-19(28)26-15-4-2-14(25)3-5-15)12(9-13)10-18-21(31)27(23(35)36-18)16(22(32)33)6-8-20(29)30/h1-5,7,9-10,16H,6,8,11H2,(H,26,28)(H,29,30)(H,32,33)/b18-10- |
| InChIKey | FFSASBFLQDTJEB-ZDLGFXPLSA-N |
| XLogP | 4.64 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|