C27H20Cl2N2O5S2 — CID 132585504
2-[(5Z)-5-[[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 132585504) has the molecular formula C27H20Cl2N2O5S2 and a molecular weight of 587.51 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[(5Z)-5-[[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 132585504 |
| Molecular Formula | C27H20Cl2N2O5S2 |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 586.02 |
| IUPAC Name | 2-[(5Z)-5-[[5-chloro-2-[2-(4-chloroanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | O=C(COc1ccc(Cl)cc1/C=C1\SC(=S)N(C(Cc2ccccc2)C(=O)O)C1=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20Cl2N2O5S2/c28-18-6-9-20(10-7-18)30-24(32)15-36-22-11-8-19(29)13-17(22)14-23-25(33)31(27(37)38-23)21(26(34)35)12-16-4-2-1-3-5-16/h1-11,13-14,21H,12,15H2,(H,30,32)(H,34,35)/b23-14- |
| InChIKey | PCAVFXHHUCEZPA-UCQKPKSFSA-N |
| XLogP | 5.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|