C29H25N3O8 — CID 142623826
[4-[3-(dimethylcarbamoyl)-4-formylbenzoyl]oxy-3-methylphenyl] 2-(ethylamino)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 142623826) has the molecular formula C29H25N3O8 and a molecular weight of 543.53 g/mol. Its IUPAC name is [4-[3-(dimethylcarbamoyl)-4-formylbenzoyl]oxy-3-methylphenyl] 2-(ethylamino)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[3-(dimethylcarbamoyl)-4-formylbenzoyl]oxy-3-methylphenyl] 2-(ethylamino)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 142623826 |
| Molecular Formula | C29H25N3O8 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | [4-[3-(dimethylcarbamoyl)-4-formylbenzoyl]oxy-3-methylphenyl] 2-(ethylamino)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCNN1C(=O)c2ccc(C(=O)Oc3ccc(OC(=O)c4ccc(C=O)c(C(=O)N(C)C)c4)c(C)c3)cc2C1=O |
| InChI | InChI=1S/C29H25N3O8/c1-5-30-32-26(35)21-10-8-18(14-23(21)27(32)36)28(37)39-20-9-11-24(16(2)12-20)40-29(38)17-6-7-19(15-33)22(13-17)25(34)31(3)4/h6-15,30H,5H2,1-4H3 |
| InChIKey | OYRWZLNOASDCNY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|