C44H42N2O8 — CID 142623828
[4-[7-[4-[3-[formyl(methyl)carbamoyl]-4-methylbenzoyl]oxyphenyl]-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 142623828) has the molecular formula C44H42N2O8 and a molecular weight of 726.83 g/mol. Its IUPAC name is [4-[7-[4-[3-[formyl(methyl)carbamoyl]-4-methylbenzoyl]oxyphenyl]-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-[7-[4-[3-[formyl(methyl)carbamoyl]-4-methylbenzoyl]oxyphenyl]-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 142623828 |
| Molecular Formula | C44H42N2O8 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | [4-[7-[4-[3-[formyl(methyl)carbamoyl]-4-methylbenzoyl]oxyphenyl]-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C3(C)CC4CC(C3)CC(C)(c3ccc(OC(=O)c5ccc6c(c5)C(=O)N(C)C6=O)cc3)C4)cc2)cc1C(=O)N(C)C=O |
| InChI | InChI=1S/C44H42N2O8/c1-26-6-7-29(19-36(26)38(48)45(4)25-47)41(51)53-33-13-9-31(10-14-33)43(2)21-27-18-28(22-43)24-44(3,23-27)32-11-15-34(16-12-32)54-42(52)30-8-17-35-37(20-30)40(50)46(5)39(35)49/h6-17,19-20,25,27-28H,18,21-24H2,1-5H3 |
| InChIKey | XZUXCZGGUWIEAS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|