C47H34N2O8 — CID 163389058
[4-[9-[4-(1,3-dioxoisoindole-5-carbonyl)oxyphenyl]fluoren-9-yl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate;propane (PubChem CID 163389058) has the molecular formula C47H34N2O8 and a molecular weight of 754.79 g/mol. Its IUPAC name is [4-[9-[4-(1,3-dioxoisoindole-5-carbonyl)oxyphenyl]fluoren-9-yl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate;propane.
| Compound Name | [4-[9-[4-(1,3-dioxoisoindole-5-carbonyl)oxyphenyl]fluoren-9-yl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate;propane |
|---|---|
| PubChem CID | 163389058 |
| Molecular Formula | C47H34N2O8 |
| Molecular Weight | 754.79 g/mol |
| Exact Mass | 754.23 |
| IUPAC Name | [4-[9-[4-(1,3-dioxoisoindole-5-carbonyl)oxyphenyl]fluoren-9-yl]phenyl] 2-methyl-1,3-dioxoisoindole-5-carboxylate;propane |
| SMILES | CCC.CN1C(=O)c2ccc(C(=O)Oc3ccc(C4(c5ccc(OC(=O)c6ccc7c(c6)C(=O)NC7=O)cc5)c5ccccc5-c5ccccc54)cc3)cc2C1=O |
| InChI | InChI=1S/C44H26N2O8.C3H8/c1-46-40(49)33-21-11-25(23-35(33)41(46)50)43(52)54-29-18-14-27(15-19-29)44(36-8-4-2-6-30(36)31-7-3-5-9-37(31)44)26-12-16-28(17-13-26)53-42(51)24-10-20-32-34(22-24)39(48)45-38(32)47;1-3-2/h2-23H,1H3,(H,45,47,48);3H2,1-2H3 |
| InChIKey | KXHKDRBEXVNJDN-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.79 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|