About but-3-ynyl 3-(methylcarbamoyl)benzoate
but-3-ynyl 3-(methylcarbamoyl)benzoate (PubChem CID 71988249) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is but-3-ynyl 3-(methylcarbamoyl)benzoate.
Molecular Properties
| Compound Name | but-3-ynyl 3-(methylcarbamoyl)benzoate |
| PubChem CID | 71988249 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | but-3-ynyl 3-(methylcarbamoyl)benzoate |
| SMILES | C#CCCOC(=O)c1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C13H13NO3/c1-3-4-8-17-13(16)11-7-5-6-10(9-11)12(15)14-2/h1,5-7,9H,4,8H2,2H3,(H,14,15) |
| InChIKey | XEFRFOKVPITOQL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl 3-(methylcarbamoyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl 3-(methylcarbamoyl)benzoate?
The IUPAC name of but-3-ynyl 3-(methylcarbamoyl)benzoate (CID 71988249) is but-3-ynyl 3-(methylcarbamoyl)benzoate.
What is the SMILES notation for but-3-ynyl 3-(methylcarbamoyl)benzoate?
The canonical SMILES for but-3-ynyl 3-(methylcarbamoyl)benzoate is C#CCCOC(=O)c1cccc(C(=O)NC)c1.
What is the InChIKey of but-3-ynyl 3-(methylcarbamoyl)benzoate?
The InChIKey is XEFRFOKVPITOQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c1-3-4-8-17-13(16)11-7-5-6-10(9-11)12(15)14-2/h1,5-7,9H,4,8H2,2H3,(H,14,15).
What are the key properties of but-3-ynyl 3-(methylcarbamoyl)benzoate?
but-3-ynyl 3-(methylcarbamoyl)benzoate has a molecular weight of 231.25 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl 3-(methylcarbamoyl)benzoate is sourced from PubChem (CID 71988249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).