C16H17NO3 — CID 71976406
1-cyclopropylbut-3-ynyl 3-(methylcarbamoyl)benzoate (PubChem CID 71976406) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-cyclopropylbut-3-ynyl 3-(methylcarbamoyl)benzoate.
| Compound Name | 1-cyclopropylbut-3-ynyl 3-(methylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 71976406 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-cyclopropylbut-3-ynyl 3-(methylcarbamoyl)benzoate |
| SMILES | C#CCC(OC(=O)c1cccc(C(=O)NC)c1)C1CC1 |
| InChI | InChI=1S/C16H17NO3/c1-3-5-14(11-8-9-11)20-16(19)13-7-4-6-12(10-13)15(18)17-2/h1,4,6-7,10-11,14H,5,8-9H2,2H3,(H,17,18) |
| InChIKey | HAGNUKFEQRBTGZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|