C20H20N4O7 — CID 159056671
2-ethyl-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;N-ethyl-2-methyl-1,3-dioxoisoindole-5-carboxamide (PubChem CID 159056671) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-ethyl-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;N-ethyl-2-methyl-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-ethyl-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;N-ethyl-2-methyl-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 159056671 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-ethyl-6-methyl-2,6-diazaspiro[3.3]heptane-1,3,5,7-tetrone;N-ethyl-2-methyl-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCN1C(=O)C2(C(=O)N(C)C2=O)C1=O.CCNC(=O)c1ccc2c(c1)C(=O)N(C)C2=O |
| InChI | InChI=1S/C12H12N2O3.C8H8N2O4/c1-3-13-10(15)7-4-5-8-9(6-7)12(17)14(2)11(8)16;1-3-10-6(13)8(7(10)14)4(11)9(2)5(8)12/h4-6H,3H2,1-2H3,(H,13,15);3H2,1-2H3 |
| InChIKey | JXYFJLVUULHSRB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 141.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|