C26H28O3 — CID 58805684
[4-(4-methoxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenyl] benzoate (PubChem CID 58805684) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [4-(4-methoxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenyl] benzoate.
| Compound Name | [4-(4-methoxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenyl] benzoate |
|---|---|
| PubChem CID | 58805684 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [4-(4-methoxy-2,3,5-trimethylphenyl)-2,3,6-trimethylphenyl] benzoate |
| SMILES | COc1c(C)cc(-c2cc(C)c(OC(=O)c3ccccc3)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C26H28O3/c1-15-13-22(17(3)19(5)24(15)28-7)23-14-16(2)25(20(6)18(23)4)29-26(27)21-11-9-8-10-12-21/h8-14H,1-7H3 |
| InChIKey | WBSDBKBBZOVGLV-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|