C19H19NO3 — CID 4006368
2-(4-methoxy-2,3,5-trimethylphenyl)indolizine-1-carboxylic acid (PubChem CID 4006368) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(4-methoxy-2,3,5-trimethylphenyl)indolizine-1-carboxylic acid.
| Compound Name | 2-(4-methoxy-2,3,5-trimethylphenyl)indolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 4006368 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-(4-methoxy-2,3,5-trimethylphenyl)indolizine-1-carboxylic acid |
| SMILES | COc1c(C)cc(-c2cn3ccccc3c2C(=O)O)c(C)c1C |
| InChI | InChI=1S/C19H19NO3/c1-11-9-14(12(2)13(3)18(11)23-4)15-10-20-8-6-5-7-16(20)17(15)19(21)22/h5-10H,1-4H3,(H,21,22) |
| InChIKey | LBKVPPLBVHSTBC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |