C23H27NO4 — CID 3336525
2-(4-tert-butyl-2,5-diethoxyphenyl)indolizine-1-carboxylic acid (PubChem CID 3336525) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,5-diethoxyphenyl)indolizine-1-carboxylic acid.
| Compound Name | 2-(4-tert-butyl-2,5-diethoxyphenyl)indolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 3336525 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-(4-tert-butyl-2,5-diethoxyphenyl)indolizine-1-carboxylic acid |
| SMILES | CCOc1cc(C(C)(C)C)c(OCC)cc1-c1cn2ccccc2c1C(=O)O |
| InChI | InChI=1S/C23H27NO4/c1-6-27-19-13-17(23(3,4)5)20(28-7-2)12-15(19)16-14-24-11-9-8-10-18(24)21(16)22(25)26/h8-14H,6-7H2,1-5H3,(H,25,26) |
| InChIKey | IGGPIWBIFYPIQX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |