C15H23NO3 — CID 67947071
[(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate;hydrate (PubChem CID 67947071) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate;hydrate.
| Compound Name | [(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate;hydrate |
|---|---|
| PubChem CID | 67947071 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [(1R,5S)-3,3,5-trimethylcyclohexyl] pyridine-3-carboxylate;hydrate |
| SMILES | C[C@@H]1C[C@@H](OC(=O)c2cccnc2)CC(C)(C)C1.O |
| InChI | InChI=1S/C15H21NO2.H2O/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12;/h4-6,10-11,13H,7-9H2,1-3H3;1H2/t11-,13-;/m1./s1 |
| InChIKey | GWIBSEAPOADUTM-LOCPCMAASA-N |
| XLogP | 2.63 |
| TPSA | 70.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |