C13H18N4O — CID 143564697
3-imino-N-[(3R)-1-methylpyrrolidin-3-yl]-3-pyridin-3-ylpropanamide (PubChem CID 143564697) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-imino-N-[(3R)-1-methylpyrrolidin-3-yl]-3-pyridin-3-ylpropanamide.
| Compound Name | 3-imino-N-[(3R)-1-methylpyrrolidin-3-yl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 143564697 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-imino-N-[(3R)-1-methylpyrrolidin-3-yl]-3-pyridin-3-ylpropanamide |
| SMILES | [H]/N=C(\CC(=O)N[C@@H]1CCN(C)C1)c1cccnc1 |
| InChI | InChI=1S/C13H18N4O/c1-17-6-4-11(9-17)16-13(18)7-12(14)10-3-2-5-15-8-10/h2-3,5,8,11,14H,4,6-7,9H2,1H3,(H,16,18)/b14-12+/t11-/m1/s1 |
| InChIKey | VFWIQYKVCGOGEV-UWYSJPFYSA-N |
| XLogP | 0.66 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|