C18H21NO — CID 58111495
(4S,7aR,12bR)-7,9-dimethyl-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 58111495) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is (4S,7aR,12bR)-7,9-dimethyl-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4S,7aR,12bR)-7,9-dimethyl-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 58111495 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (4S,7aR,12bR)-7,9-dimethyl-1,2,3,4,4a,5,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | CC1=CCC2[C@@H]3Cc4ccc(C)c5c4[C@]2(CCN3)[C@@H]1O5 |
| InChI | InChI=1S/C18H21NO/c1-10-3-5-12-9-14-13-6-4-11(2)17-18(13,7-8-19-14)15(12)16(10)20-17/h3-5,13-14,17,19H,6-9H2,1-2H3/t13?,14-,17+,18+/m0/s1 |
| InChIKey | AYCFRSCJBIBMCA-YAKTYBBCSA-N |
| XLogP | 2.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|