C17H21NO4 — CID 71012638
1-[(1R,2R,10R,15S)-5,15-dihydroxy-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]butan-1-one (PubChem CID 71012638) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[(1R,2R,10R,15S)-5,15-dihydroxy-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]butan-1-one.
| Compound Name | 1-[(1R,2R,10R,15S)-5,15-dihydroxy-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]butan-1-one |
|---|---|
| PubChem CID | 71012638 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[(1R,2R,10R,15S)-5,15-dihydroxy-3-oxa-11-azatetracyclo[6.5.1.11,10.04,14]pentadeca-4,6,8(14)-trien-2-yl]butan-1-one |
| SMILES | CCCC(=O)[C@@H]1Oc2c(O)ccc3c2[C@@]12CCN[C@H](C3)[C@H]2O |
| InChI | InChI=1S/C17H21NO4/c1-2-3-12(20)16-17-6-7-18-10(15(17)21)8-9-4-5-11(19)14(22-16)13(9)17/h4-5,10,15-16,18-19,21H,2-3,6-8H2,1H3/t10-,15-,16+,17-/m1/s1 |
| InChIKey | WKOUXSWQQLRDKV-PEWLAIEXSA-N |
| XLogP | 1.04 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |