C17H18NO2P — CID 162295280
(4R,7aS,12bS)-7-methyl-9-phosphoroso-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 162295280) has the molecular formula C17H18NO2P and a molecular weight of 299.31 g/mol. Its IUPAC name is (4R,7aS,12bS)-7-methyl-9-phosphoroso-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,7aS,12bS)-7-methyl-9-phosphoroso-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 162295280 |
| Molecular Formula | C17H18NO2P |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (4R,7aS,12bS)-7-methyl-9-phosphoroso-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | CC1C=CC2[C@H]3Cc4ccc(P=O)c5c4[C@@]2(CCN3)[C@H]1O5 |
| InChI | InChI=1S/C17H18NO2P/c1-9-2-4-11-12-8-10-3-5-13(21-19)15-14(10)17(11,6-7-18-12)16(9)20-15/h2-5,9,11-12,16,18H,6-8H2,1H3/t9?,11?,12-,16+,17+/m1/s1 |
| InChIKey | CNKXXTTWYLUTFN-FZJUBYSGSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|