C24H29NO9 — CID 169444874
(2S,3S,4S,5R)-6-[[(4R,4aR,7S,7aR,12bS)-9-ethoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 169444874) has the molecular formula C24H29NO9 and a molecular weight of 475.49 g/mol. Its IUPAC name is (2S,3S,4S,5R)-6-[[(4R,4aR,7S,7aR,12bS)-9-ethoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-6-[[(4R,4aR,7S,7aR,12bS)-9-ethoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 169444874 |
| Molecular Formula | C24H29NO9 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (2S,3S,4S,5R)-6-[[(4R,4aR,7S,7aR,12bS)-9-ethoxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCOc1ccc2c3c1O[C@H]1[C@@H](OC4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)C=C[C@H]4[C@@H](C2)NCC[C@@]341 |
| InChI | InChI=1S/C24H29NO9/c1-2-31-13-5-3-10-9-12-11-4-6-14(21-24(11,7-8-25-12)15(10)19(13)33-21)32-23-18(28)16(26)17(27)20(34-23)22(29)30/h3-6,11-12,14,16-18,20-21,23,25-28H,2,7-9H2,1H3,(H,29,30)/t11-,12+,14-,16-,17-,18+,20-,21-,23?,24-/m0/s1 |
| InChIKey | PRMGJBKITDMZQL-CJXISONYSA-N |
| XLogP | -0.53 |
| TPSA | 146.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|