C22H33NO3Si2 — CID 591319
trimethyl-[(7-trimethylsilyloxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl)oxy]silane (PubChem CID 591319) has the molecular formula C22H33NO3Si2 and a molecular weight of 415.68 g/mol. Its IUPAC name is trimethyl-[(7-trimethylsilyloxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl)oxy]silane.
| Compound Name | trimethyl-[(7-trimethylsilyloxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl)oxy]silane |
|---|---|
| PubChem CID | 591319 |
| Molecular Formula | C22H33NO3Si2 |
| Molecular Weight | 415.68 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | trimethyl-[(7-trimethylsilyloxy-1,2,3,4,4a,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl)oxy]silane |
| SMILES | C[Si](C)(C)Oc1ccc2c3c1OC1C(O[Si](C)(C)C)C=CC4C(C2)NCCC341 |
| InChI | InChI=1S/C22H33NO3Si2/c1-27(2,3)25-17-9-7-14-13-16-15-8-10-18(26-28(4,5)6)21-22(15,11-12-23-16)19(14)20(17)24-21/h7-10,15-16,18,21,23H,11-13H2,1-6H3 |
| InChIKey | YKVXAFBDBPVFMP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.68 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|