C19H20NO2P — CID 162295282
(1R,2S,6R,14S,15R)-15-methyl-11-phosphoroso-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene (PubChem CID 162295282) has the molecular formula C19H20NO2P and a molecular weight of 325.35 g/mol. Its IUPAC name is (1R,2S,6R,14S,15R)-15-methyl-11-phosphoroso-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene.
| Compound Name | (1R,2S,6R,14S,15R)-15-methyl-11-phosphoroso-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene |
|---|---|
| PubChem CID | 162295282 |
| Molecular Formula | C19H20NO2P |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (1R,2S,6R,14S,15R)-15-methyl-11-phosphoroso-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraene |
| SMILES | C[C@]12C=C[C@@]3(CC1)[C@H]1Cc4ccc(P=O)c5c4[C@@]3(CCN1)[C@H]2O5 |
| InChI | InChI=1S/C19H20NO2P/c1-17-4-6-18(7-5-17)13-10-11-2-3-12(23-21)15-14(11)19(18,8-9-20-13)16(17)22-15/h2-4,6,13,16,20H,5,7-10H2,1H3/t13-,16+,17+,18-,19+/m1/s1 |
| InChIKey | KQOKRDNEJVBLRO-DTBDJWGBSA-N |
| XLogP | 2.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|