C19H23NO5 — CID 139393233
(4R,4aS,7aR)-9-methoxyspiro[1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane]-4a-ol (PubChem CID 139393233) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is (4R,4aS,7aR)-9-methoxyspiro[1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane]-4a-ol.
| Compound Name | (4R,4aS,7aR)-9-methoxyspiro[1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane]-4a-ol |
|---|---|
| PubChem CID | 139393233 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (4R,4aS,7aR)-9-methoxyspiro[1,2,3,4,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7,2'-1,3-dioxolane]-4a-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C4(CC[C@@]5(O)[C@@H](C2)NCCC315)OCCO4 |
| InChI | InChI=1S/C19H23NO5/c1-22-12-3-2-11-10-13-18(21)4-5-19(23-8-9-24-19)16-17(18,6-7-20-13)14(11)15(12)25-16/h2-3,13,16,20-21H,4-10H2,1H3/t13-,16-,17?,18-/m1/s1 |
| InChIKey | LUTWQTSWADIOIJ-LOARFCKPSA-N |
| XLogP | 0.88 |
| TPSA | 69.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |